C13H10N6O3 — CID 155808042
N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155808042) has the molecular formula C13H10N6O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155808042 |
| Molecular Formula | C13H10N6O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1)c1cnc2nc[nH]n2c1=O |
| InChI | InChI=1S/C13H10N6O3/c20-9-3-1-8(2-4-9)5-16-18-11(21)10-6-14-13-15-7-17-19(13)12(10)22/h1-7,20H,(H,18,21)(H,14,15,17)/b16-5+ |
| InChIKey | ULVJRWGKWJZQTI-FZSIALSZSA-N |
| XLogP | -0.11 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|