C14H12N6O3 — CID 155815523
N-[(E)-(4-methoxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155815523) has the molecular formula C14H12N6O3 and a molecular weight of 312.29 g/mol. Its IUPAC name is N-[(E)-(4-methoxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155815523 |
| Molecular Formula | C14H12N6O3 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cnc3nc[nH]n3c2=O)cc1 |
| InChI | InChI=1S/C14H12N6O3/c1-23-10-4-2-9(3-5-10)6-17-19-12(21)11-7-15-14-16-8-18-20(14)13(11)22/h2-8H,1H3,(H,19,21)(H,15,16,18)/b17-6+ |
| InChIKey | ZRYRMROMQJUHBF-UBKPWBPPSA-N |
| XLogP | 0.19 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|