C30H26ClN5O4 — CID 71473029
4-chloro-N-[(E)-(4-methoxyphenyl)methylideneamino]-2-[2-[[(E)-(4-methoxyphenyl)methylideneamino]carbamoyl]anilino]benzamide (PubChem CID 71473029) has the molecular formula C30H26ClN5O4 and a molecular weight of 556.02 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(4-methoxyphenyl)methylideneamino]-2-[2-[[(E)-(4-methoxyphenyl)methylideneamino]carbamoyl]anilino]benzamide.
| Compound Name | 4-chloro-N-[(E)-(4-methoxyphenyl)methylideneamino]-2-[2-[[(E)-(4-methoxyphenyl)methylideneamino]carbamoyl]anilino]benzamide |
|---|---|
| PubChem CID | 71473029 |
| Molecular Formula | C30H26ClN5O4 |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 4-chloro-N-[(E)-(4-methoxyphenyl)methylideneamino]-2-[2-[[(E)-(4-methoxyphenyl)methylideneamino]carbamoyl]anilino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccccc2Nc2cc(Cl)ccc2C(=O)N/N=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H26ClN5O4/c1-39-23-12-7-20(8-13-23)18-32-35-29(37)25-5-3-4-6-27(25)34-28-17-22(31)11-16-26(28)30(38)36-33-19-21-9-14-24(40-2)15-10-21/h3-19,34H,1-2H3,(H,35,37)(H,36,38)/b32-18+,33-19+ |
| InChIKey | TZQWMMXZQQPQJZ-XYHIKERESA-N |
| XLogP | 5.63 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|