C22H21N3O — CID 155808877
(2Z)-2-[(1-benzylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 155808877) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is (2Z)-2-[(1-benzylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | (2Z)-2-[(1-benzylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 155808877 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2Z)-2-[(1-benzylpyrrolo[2,3-b]pyridin-3-yl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | O=C1/C(=C/c2cn(Cc3ccccc3)c3ncccc23)N2CCC1CC2 |
| InChI | InChI=1S/C22H21N3O/c26-21-17-8-11-24(12-9-17)20(21)13-18-15-25(14-16-5-2-1-3-6-16)22-19(18)7-4-10-23-22/h1-7,10,13,15,17H,8-9,11-12,14H2/b20-13- |
| InChIKey | MMZWLMVQSCCJIJ-MOSHPQCFSA-N |
| XLogP | 3.72 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|