C31H35N3O2S — CID 42627940
(3S,4R,4aS,8aR)-3-(1-benzylpyrrolo[2,3-b]pyridin-3-yl)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 42627940) has the molecular formula C31H35N3O2S and a molecular weight of 513.71 g/mol. Its IUPAC name is (3S,4R,4aS,8aR)-3-(1-benzylpyrrolo[2,3-b]pyridin-3-yl)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | (3S,4R,4aS,8aR)-3-(1-benzylpyrrolo[2,3-b]pyridin-3-yl)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 42627940 |
| Molecular Formula | C31H35N3O2S |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | (3S,4R,4aS,8aR)-3-(1-benzylpyrrolo[2,3-b]pyridin-3-yl)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CCCC[C@@H]3[C@@H](C)[C@H]2c2cn(Cc3ccccc3)c3ncccc23)cc1 |
| InChI | InChI=1S/C31H35N3O2S/c1-22-14-16-26(17-15-22)37(35,36)34-20-25-11-6-7-12-27(25)23(2)30(34)29-21-33(19-24-9-4-3-5-10-24)31-28(29)13-8-18-32-31/h3-5,8-10,13-18,21,23,25,27,30H,6-7,11-12,19-20H2,1-2H3/t23-,25+,27-,30+/m1/s1 |
| InChIKey | AAHYFTQZIMLODW-DYSFMPHVSA-N |
| XLogP | 6.58 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |