C19H19F3N2OS — CID 155814346
N-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiomorpholine-2-carboxamide (PubChem CID 155814346) has the molecular formula C19H19F3N2OS and a molecular weight of 380.44 g/mol. Its IUPAC name is N-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiomorpholine-2-carboxamide.
| Compound Name | N-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiomorpholine-2-carboxamide |
|---|---|
| PubChem CID | 155814346 |
| Molecular Formula | C19H19F3N2OS |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-phenyl-4-[[4-(trifluoromethyl)phenyl]methyl]thiomorpholine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CN(Cc2ccc(C(F)(F)F)cc2)CCS1 |
| InChI | InChI=1S/C19H19F3N2OS/c20-19(21,22)15-8-6-14(7-9-15)12-24-10-11-26-17(13-24)18(25)23-16-4-2-1-3-5-16/h1-9,17H,10-13H2,(H,23,25) |
| InChIKey | YVGYEFBQRIAEAZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |