C34H36N8O4 — CID 155815033
N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-[[9-[2-(4-methoxyphenyl)-2-oxoethyl]purin-6-yl]amino]-4-methylbenzamide (PubChem CID 155815033) has the molecular formula C34H36N8O4 and a molecular weight of 620.71 g/mol. Its IUPAC name is N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-[[9-[2-(4-methoxyphenyl)-2-oxoethyl]purin-6-yl]amino]-4-methylbenzamide.
| Compound Name | N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-[[9-[2-(4-methoxyphenyl)-2-oxoethyl]purin-6-yl]amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 155815033 |
| Molecular Formula | C34H36N8O4 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | N-[4-[4-(2-hydroxyethyl)piperazin-1-yl]phenyl]-3-[[9-[2-(4-methoxyphenyl)-2-oxoethyl]purin-6-yl]amino]-4-methylbenzamide |
| SMILES | COc1ccc(C(=O)Cn2cnc3c(Nc4cc(C(=O)Nc5ccc(N6CCN(CCO)CC6)cc5)ccc4C)ncnc32)cc1 |
| InChI | InChI=1S/C34H36N8O4/c1-23-3-4-25(34(45)38-26-7-9-27(10-8-26)41-15-13-40(14-16-41)17-18-43)19-29(23)39-32-31-33(36-21-35-32)42(22-37-31)20-30(44)24-5-11-28(46-2)12-6-24/h3-12,19,21-22,43H,13-18,20H2,1-2H3,(H,38,45)(H,35,36,39) |
| InChIKey | WHQGCPXHGQCLMQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|