C17H14N6O — CID 155816979
2-[5-amino-1-(4-methylphenyl)triazol-4-yl]-3H-quinazolin-4-one (PubChem CID 155816979) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-[5-amino-1-(4-methylphenyl)triazol-4-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[5-amino-1-(4-methylphenyl)triazol-4-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 155816979 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[5-amino-1-(4-methylphenyl)triazol-4-yl]-3H-quinazolin-4-one |
| SMILES | Cc1ccc(-n2nnc(-c3nc4ccccc4c(=O)[nH]3)c2N)cc1 |
| InChI | InChI=1S/C17H14N6O/c1-10-6-8-11(9-7-10)23-15(18)14(21-22-23)16-19-13-5-3-2-4-12(13)17(24)20-16/h2-9H,18H2,1H3,(H,19,20,24) |
| InChIKey | VMWDVBRWBJYBSF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |