C18H17N3O6S — CID 155819077
4-nitro-N-[2-oxo-2-(2-oxo-4-phenylpyrrolidin-1-yl)ethyl]benzenesulfonamide (PubChem CID 155819077) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is 4-nitro-N-[2-oxo-2-(2-oxo-4-phenylpyrrolidin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[2-oxo-2-(2-oxo-4-phenylpyrrolidin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155819077 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 4-nitro-N-[2-oxo-2-(2-oxo-4-phenylpyrrolidin-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)N1CC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C18H17N3O6S/c22-17-10-14(13-4-2-1-3-5-13)12-20(17)18(23)11-19-28(26,27)16-8-6-15(7-9-16)21(24)25/h1-9,14,19H,10-12H2 |
| InChIKey | MXBCHAVIWNDLAP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|