C20H16FN5OS2 — CID 155819092
5-[[4-(dimethylamino)phenyl]methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 155819092) has the molecular formula C20H16FN5OS2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)phenyl]methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155819092 |
| Molecular Formula | C20H16FN5OS2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 5-[[4-(dimethylamino)phenyl]methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(C=C2SC(=Nc3nnc(-c4cccc(F)c4)s3)NC2=O)cc1 |
| InChI | InChI=1S/C20H16FN5OS2/c1-26(2)15-8-6-12(7-9-15)10-16-17(27)22-19(28-16)23-20-25-24-18(29-20)13-4-3-5-14(21)11-13/h3-11H,1-2H3,(H,22,23,25,27) |
| InChIKey | QAIFYRWHNIPVIQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|