C18H10BrFN4OS2 — CID 155819070
5-[(2-bromophenyl)methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 155819070) has the molecular formula C18H10BrFN4OS2 and a molecular weight of 461.34 g/mol. Its IUPAC name is 5-[(2-bromophenyl)methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-bromophenyl)methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155819070 |
| Molecular Formula | C18H10BrFN4OS2 |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 459.95 |
| IUPAC Name | 5-[(2-bromophenyl)methylidene]-2-[[5-(3-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=Nc2nnc(-c3cccc(F)c3)s2)SC1=Cc1ccccc1Br |
| InChI | InChI=1S/C18H10BrFN4OS2/c19-13-7-2-1-4-10(13)9-14-15(25)21-17(26-14)22-18-24-23-16(27-18)11-5-3-6-12(20)8-11/h1-9H,(H,21,22,24,25) |
| InChIKey | ZCIFCSUAFOSWRW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|