C20H15FN4O3S2 — CID 155819115
5-[(3,4-dimethoxyphenyl)methylidene]-2-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one (PubChem CID 155819115) has the molecular formula C20H15FN4O3S2 and a molecular weight of 442.50 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methylidene]-2-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methylidene]-2-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155819115 |
| Molecular Formula | C20H15FN4O3S2 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methylidene]-2-[[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]imino]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2SC(=Nc3nnc(-c4ccc(F)cc4)s3)NC2=O)cc1OC |
| InChI | InChI=1S/C20H15FN4O3S2/c1-27-14-8-3-11(9-15(14)28-2)10-16-17(26)22-19(29-16)23-20-25-24-18(30-20)12-4-6-13(21)7-5-12/h3-10H,1-2H3,(H,22,23,25,26) |
| InChIKey | YKNSTRHWSDPGDL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|