C6H12ClF2NO — CID 155821044
(1S)-2,2-difluoro-1-(oxolan-3-yl)ethanamine;hydrochloride (PubChem CID 155821044) has the molecular formula C6H12ClF2NO and a molecular weight of 187.62 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-(oxolan-3-yl)ethanamine;hydrochloride.
| Compound Name | (1S)-2,2-difluoro-1-(oxolan-3-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 155821044 |
| Molecular Formula | C6H12ClF2NO |
| Molecular Weight | 187.62 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | (1S)-2,2-difluoro-1-(oxolan-3-yl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@H](C(F)F)C1CCOC1 |
| InChI | InChI=1S/C6H11F2NO.ClH/c7-6(8)5(9)4-1-2-10-3-4;/h4-6H,1-3,9H2;1H/t4?,5-;/m0./s1 |
| InChIKey | OKVZBXDUKXVWTQ-YKXIHYLHSA-N |
| XLogP | 1.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.62 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |