C7H14ClF2NO — CID 155822311
(1S)-2,2-difluoro-1-(oxan-4-yl)ethanamine;hydrochloride (PubChem CID 155822311) has the molecular formula C7H14ClF2NO and a molecular weight of 201.64 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-(oxan-4-yl)ethanamine;hydrochloride.
| Compound Name | (1S)-2,2-difluoro-1-(oxan-4-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 155822311 |
| Molecular Formula | C7H14ClF2NO |
| Molecular Weight | 201.64 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | (1S)-2,2-difluoro-1-(oxan-4-yl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@H](C(F)F)C1CCOCC1 |
| InChI | InChI=1S/C7H13F2NO.ClH/c8-7(9)6(10)5-1-3-11-4-2-5;/h5-7H,1-4,10H2;1H/t6-;/m0./s1 |
| InChIKey | FSHNIZLDJNJIAN-RGMNGODLSA-N |
| XLogP | 1.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |