C15H21F3N4O5S — CID 155823570
(3aR,6aS)-4-ethylsulfonyl-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155823570) has the molecular formula C15H21F3N4O5S and a molecular weight of 426.42 g/mol. Its IUPAC name is (3aR,6aS)-4-ethylsulfonyl-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-4-ethylsulfonyl-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155823570 |
| Molecular Formula | C15H21F3N4O5S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (3aR,6aS)-4-ethylsulfonyl-1-(6-methoxypyrimidin-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)N1CC[C@H]2[C@H]1CCN2c1cc(OC)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N4O3S.C2HF3O2/c1-3-21(18,19)17-7-5-10-11(17)4-6-16(10)12-8-13(20-2)15-9-14-12;3-2(4,5)1(6)7/h8-11H,3-7H2,1-2H3;(H,6,7)/t10-,11+;/m0./s1 |
| InChIKey | JFZAGYOGHXIXLE-VZXYPILPSA-N |
| XLogP | 1.12 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |