C14H22N4O3S — CID 98777223
(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-propylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 98777223) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-propylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-propylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 98777223 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-propylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | CCCS(=O)(=O)N1CC[C@H]2[C@H]1CCN2c1cc(OC)ncn1 |
| InChI | InChI=1S/C14H22N4O3S/c1-3-8-22(19,20)18-7-5-11-12(18)4-6-17(11)13-9-14(21-2)16-10-15-13/h9-12H,3-8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | CFCGUBJNVSECLC-NWDGAFQWSA-N |
| XLogP | 0.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |