C14H19F3N4O5S — CID 155859360
(3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155859360) has the molecular formula C14H19F3N4O5S and a molecular weight of 412.39 g/mol. Its IUPAC name is (3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155859360 |
| Molecular Formula | C14H19F3N4O5S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (3aR,6aS)-1-(6-methoxypyrimidin-4-yl)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2CC[C@@H]3[C@@H]2CCN3S(C)(=O)=O)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H18N4O3S.C2HF3O2/c1-19-12-7-11(13-8-14-12)15-5-3-10-9(15)4-6-16(10)20(2,17)18;3-2(4,5)1(6)7/h7-10H,3-6H2,1-2H3;(H,6,7)/t9-,10+;/m0./s1 |
| InChIKey | KMQSSBXZRDUZJK-BAUSSPIASA-N |
| XLogP | 0.73 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |