C21H29F6N3O6S — CID 155824065
(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155824065) has the molecular formula C21H29F6N3O6S and a molecular weight of 565.53 g/mol. Its IUPAC name is (4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155824065 |
| Molecular Formula | C21H29F6N3O6S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | (4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-8-morpholin-4-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ncsc1CN1C[C@@H]2CCCO[C@@H]2[C@H](N2CCOCC2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O2S.2C2HF3O2/c1-13-16(23-12-18-13)11-19-9-14-3-2-6-22-17(14)15(10-19)20-4-7-21-8-5-20;2*3-2(4,5)1(6)7/h12,14-15,17H,2-11H2,1H3;2*(H,6,7)/t14-,15+,17-;;/m0../s1 |
| InChIKey | LSACQIFBQDSPLQ-WMIKHVLESA-N |
| XLogP | 3.03 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |