C19H26F6N4O7S — CID 155825967
N-[[(3S,3aS,6aS)-5-(2-ethylsulfonylethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825967) has the molecular formula C19H26F6N4O7S and a molecular weight of 568.49 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(2-ethylsulfonylethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[(3S,3aS,6aS)-5-(2-ethylsulfonylethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825967 |
| Molecular Formula | C19H26F6N4O7S |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(2-ethylsulfonylethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCS(=O)(=O)CCN1C[C@@H]2[C@@H](CNc3ncccn3)CO[C@@H]2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O3S.2C2HF3O2/c1-2-23(20,21)7-6-19-9-13-12(11-22-14(13)10-19)8-18-15-16-4-3-5-17-15;2*3-2(4,5)1(6)7/h3-5,12-14H,2,6-11H2,1H3,(H,16,17,18);2*(H,6,7)/t12-,13+,14+;;/m0../s1 |
| InChIKey | NUDOGFCXABIXME-BCIMQBNMSA-N |
| XLogP | 1.54 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |