C18H26F3N5O5S — CID 155826160
N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155826160) has the molecular formula C18H26F3N5O5S and a molecular weight of 481.50 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826160 |
| Molecular Formula | C18H26F3N5O5S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1cc(N2C[C@@H]3[C@@H](CNS(=O)(=O)C4CC4)CO[C@@H]3C2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N5O3S.C2HF3O2/c1-20(2)15-5-16(18-10-17-15)21-7-13-11(9-24-14(13)8-21)6-19-25(22,23)12-3-4-12;3-2(4,5)1(6)7/h5,10-14,19H,3-4,6-9H2,1-2H3;(H,6,7)/t11-,13+,14+;/m0./s1 |
| InChIKey | SFUADARBLCRKIU-IRIHETDOSA-N |
| XLogP | 0.71 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |