C15H20F4N4O5S — CID 155831132
N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155831132) has the molecular formula C15H20F4N4O5S and a molecular weight of 444.41 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831132 |
| Molecular Formula | C15H20F4N4O5S |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)NC[C@H]1CO[C@@H]2CN(c3ncc(F)cn3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19FN4O3S.C2HF3O2/c1-2-22(19,20)17-3-9-8-21-12-7-18(6-11(9)12)13-15-4-10(14)5-16-13;3-2(4,5)1(6)7/h4-5,9,11-12,17H,2-3,6-8H2,1H3;(H,6,7)/t9-,11+,12+;/m0./s1 |
| InChIKey | ZDEPHMIEMOXWAE-SNGVRITASA-N |
| XLogP | 0.64 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |