C22H31F3N4O6 — CID 155826151
1'-butanoyl-N-(oxolan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826151) has the molecular formula C22H31F3N4O6 and a molecular weight of 504.51 g/mol. Its IUPAC name is 1'-butanoyl-N-(oxolan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1'-butanoyl-N-(oxolan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826151 |
| Molecular Formula | C22H31F3N4O6 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 1'-butanoyl-N-(oxolan-2-ylmethyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCC(=O)N1CCC2(CC1)OC(C(=O)NCC1CCCO1)Cn1ccnc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H30N4O4.C2HF3O2/c1-2-4-17(25)23-9-6-20(7-10-23)19-21-8-11-24(19)14-16(28-20)18(26)22-13-15-5-3-12-27-15;3-2(4,5)1(6)7/h8,11,15-16H,2-7,9-10,12-14H2,1H3,(H,22,26);(H,6,7) |
| InChIKey | SPMRIOVDELUMBN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |