C18H22F4N4O4 — CID 155827229
(3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155827229) has the molecular formula C18H22F4N4O4 and a molecular weight of 434.39 g/mol. Its IUPAC name is (3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827229 |
| Molecular Formula | C18H22F4N4O4 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (3aS,4R,7aS)-N-(cyclopropylmethyl)-6-(5-fluoropyrimidin-2-yl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC1CC1)[C@H]1CN(c2ncc(F)cn2)C[C@H]2OCC[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21FN4O2.C2HF3O2/c17-11-6-19-16(20-7-11)21-8-13(12-3-4-23-14(12)9-21)15(22)18-5-10-1-2-10;3-2(4,5)1(6)7/h6-7,10,12-14H,1-5,8-9H2,(H,18,22);(H,6,7)/t12-,13-,14+;/m0./s1 |
| InChIKey | QEQGGQRJSHSOKR-NPTJMSEESA-N |
| XLogP | 1.62 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |