C21H25F3N6O3 — CID 155827475
cyclohexen-1-yl-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155827475) has the molecular formula C21H25F3N6O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is cyclohexen-1-yl-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclohexen-1-yl-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827475 |
| Molecular Formula | C21H25F3N6O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | cyclohexen-1-yl-[7-[(pyrimidin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1=CCCCC1)N1Cc2ccnn2CC(CNc2ncccn2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N6O.C2HF3O2/c26-18(16-5-2-1-3-6-16)24-12-15(11-22-19-20-8-4-9-21-19)13-25-17(14-24)7-10-23-25;3-2(4,5)1(6)7/h4-5,7-10,15H,1-3,6,11-14H2,(H,20,21,22);(H,6,7) |
| InChIKey | GHIFYWXSTKAUKI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |