C20H29F3N4O4S — CID 155829956
2-ethyl-7-(2-methylpropanoyl)-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid (PubChem CID 155829956) has the molecular formula C20H29F3N4O4S and a molecular weight of 478.54 g/mol. Its IUPAC name is 2-ethyl-7-(2-methylpropanoyl)-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-ethyl-7-(2-methylpropanoyl)-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829956 |
| Molecular Formula | C20H29F3N4O4S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-ethyl-7-(2-methylpropanoyl)-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CC2(CC1=O)CN(Cc1nccs1)CCN(C(=O)C(C)C)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O2S.C2HF3O2/c1-4-21-12-18(9-16(21)23)11-20(10-15-19-5-8-25-15)6-7-22(13-18)17(24)14(2)3;3-2(4,5)1(6)7/h5,8,14H,4,6-7,9-13H2,1-3H3;(H,6,7) |
| InChIKey | JVHVHHITRIINPX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |