C19H28F3N5O4S — CID 155828399
2-methyl-3-oxo-N-propan-2-yl-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155828399) has the molecular formula C19H28F3N5O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-propan-2-yl-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methyl-3-oxo-N-propan-2-yl-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828399 |
| Molecular Formula | C19H28F3N5O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2-methyl-3-oxo-N-propan-2-yl-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)NC(=O)N1CCN(Cc2nccs2)CC2(CC(=O)N(C)C2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N5O2S.C2HF3O2/c1-13(2)19-16(24)22-6-5-21(9-14-18-4-7-25-14)11-17(12-22)8-15(23)20(3)10-17;3-2(4,5)1(6)7/h4,7,13H,5-6,8-12H2,1-3H3,(H,19,24);(H,6,7) |
| InChIKey | IVTXQAPTRDNOQS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |