C19H27F3N4O4S — CID 155849193
2-methyl-10-(2-methylpropanoyl)-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid (PubChem CID 155849193) has the molecular formula C19H27F3N4O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is 2-methyl-10-(2-methylpropanoyl)-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methyl-10-(2-methylpropanoyl)-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849193 |
| Molecular Formula | C19H27F3N4O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-methyl-10-(2-methylpropanoyl)-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C(=O)N1CCN(Cc2nccs2)CC2(CC(=O)N(C)C2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O2S.C2HF3O2/c1-13(2)16(23)21-6-5-20(9-14-18-4-7-24-14)11-17(12-21)8-15(22)19(3)10-17;3-2(4,5)1(6)7/h4,7,13H,5-6,8-12H2,1-3H3;(H,6,7) |
| InChIKey | JMMDKTYNKVPOKY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |