C17H24F3N5O4S — CID 155850121
N,N-dimethyl-3-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155850121) has the molecular formula C17H24F3N5O4S and a molecular weight of 451.47 g/mol. Its IUPAC name is N,N-dimethyl-3-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-3-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155850121 |
| Molecular Formula | C17H24F3N5O4S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N,N-dimethyl-3-oxo-7-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecane-10-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)N1CCN(Cc2nccs2)CC2(CNC(=O)C2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N5O2S.C2HF3O2/c1-18(2)14(22)20-5-4-19(8-13-16-3-6-23-13)10-15(11-20)7-12(21)17-9-15;3-2(4,5)1(6)7/h3,6H,4-5,7-11H2,1-2H3,(H,17,21);(H,6,7) |
| InChIKey | KRLBVEAINUHTBR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |