C18H25F3N4O4S — CID 155849093
7-acetyl-2-ethyl-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid (PubChem CID 155849093) has the molecular formula C18H25F3N4O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is 7-acetyl-2-ethyl-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-acetyl-2-ethyl-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849093 |
| Molecular Formula | C18H25F3N4O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 7-acetyl-2-ethyl-10-(1,3-thiazol-2-ylmethyl)-2,7,10-triazaspiro[4.6]undecan-3-one;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CC2(CC1=O)CN(Cc1nccs1)CCN(C(C)=O)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2S.C2HF3O2/c1-3-19-11-16(8-15(19)22)10-18(9-14-17-4-7-23-14)5-6-20(12-16)13(2)21;3-2(4,5)1(6)7/h4,7H,3,5-6,8-12H2,1-2H3;(H,6,7) |
| InChIKey | WKJNWFNKEGQABA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |