C19H26F3N5O4S — CID 155830086
2-(1-ethylsulfonylpiperidin-4-yl)-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155830086) has the molecular formula C19H26F3N5O4S and a molecular weight of 477.51 g/mol. Its IUPAC name is 2-(1-ethylsulfonylpiperidin-4-yl)-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(1-ethylsulfonylpiperidin-4-yl)-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830086 |
| Molecular Formula | C19H26F3N5O4S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-(1-ethylsulfonylpiperidin-4-yl)-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)N1CCC(c2nc3ccc(N4CCCC4)cn3n2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N5O2S.C2HF3O2/c1-2-25(23,24)21-11-7-14(8-12-21)17-18-16-6-5-15(13-22(16)19-17)20-9-3-4-10-20;3-2(4,5)1(6)7/h5-6,13-14H,2-4,7-12H2,1H3;(H,6,7) |
| InChIKey | IUOCBVOYKFHHJB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |