C25H29F6N5O4S — CID 155828673
2-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828673) has the molecular formula C25H29F6N5O4S and a molecular weight of 609.59 g/mol. Its IUPAC name is 2-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828673 |
| Molecular Formula | C25H29F6N5O4S |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 2-[1-[(5-methylthiophen-2-yl)methyl]piperidin-4-yl]-6-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CCC(c3nc4ccc(N5CCCC5)cn4n3)CC2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H27N5S.2C2HF3O2/c1-16-4-6-19(27-16)15-24-12-8-17(9-13-24)21-22-20-7-5-18(14-26(20)23-21)25-10-2-3-11-25;2*3-2(4,5)1(6)7/h4-7,14,17H,2-3,8-13,15H2,1H3;2*(H,6,7) |
| InChIKey | QPAKKOMEOLLAJP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |