C21H24F3N5O3S — CID 171693406
4-[2-[1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid (PubChem CID 171693406) has the molecular formula C21H24F3N5O3S and a molecular weight of 483.52 g/mol. Its IUPAC name is 4-[2-[1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171693406 |
| Molecular Formula | C21H24F3N5O3S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 4-[2-[1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cc(CN2CCC(c3nc4ccc(N5CCOCC5)cn4n3)C2)cs1 |
| InChI | InChI=1S/C19H23N5OS.C2HF3O2/c1-2-18-20-19(16-3-5-22(12-16)11-15-4-10-26-14-15)21-24(18)13-17(1)23-6-8-25-9-7-23;3-2(4,5)1(6)7/h1-2,4,10,13-14,16H,3,5-9,11-12H2;(H,6,7) |
| InChIKey | RKXQKZPIWZGDRH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |