C25H29F6N5O5S — CID 155848353
4-[2-[1-[(3-methylthiophen-2-yl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848353) has the molecular formula C25H29F6N5O5S and a molecular weight of 625.59 g/mol. Its IUPAC name is 4-[2-[1-[(3-methylthiophen-2-yl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[2-[1-[(3-methylthiophen-2-yl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848353 |
| Molecular Formula | C25H29F6N5O5S |
| Molecular Weight | 625.59 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | 4-[2-[1-[(3-methylthiophen-2-yl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccsc1CN1CCCC(c2nc3ccc(N4CCOCC4)cn3n2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H27N5OS.2C2HF3O2/c1-16-6-12-28-19(16)15-24-7-2-3-17(13-24)21-22-20-5-4-18(14-26(20)23-21)25-8-10-27-11-9-25;2*3-2(4,5)1(6)7/h4-6,12,14,17H,2-3,7-11,13,15H2,1H3;2*(H,6,7) |
| InChIKey | DRFJYOZEWKWEBX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |