C25H30F3N5O3 — CID 171695279
4-[2-[1-[(3-methylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid (PubChem CID 171695279) has the molecular formula C25H30F3N5O3 and a molecular weight of 505.54 g/mol. Its IUPAC name is 4-[2-[1-[(3-methylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[1-[(3-methylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171695279 |
| Molecular Formula | C25H30F3N5O3 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 4-[2-[1-[(3-methylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cccc(CN2CCCC(c3nc4ccc(N5CCOCC5)cn4n3)C2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H29N5O.C2HF3O2/c1-18-4-2-5-19(14-18)15-26-9-3-6-20(16-26)23-24-22-8-7-21(17-28(22)25-23)27-10-12-29-13-11-27;3-2(4,5)1(6)7/h2,4-5,7-8,14,17,20H,3,6,9-13,15-16H2,1H3;(H,6,7) |
| InChIKey | ZSTFXVXUEJJTGA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |