C26H32F3N5O3 — CID 171695440
4-[2-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid (PubChem CID 171695440) has the molecular formula C26H32F3N5O3 and a molecular weight of 519.57 g/mol. Its IUPAC name is 4-[2-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[2-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171695440 |
| Molecular Formula | C26H32F3N5O3 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 4-[2-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]morpholine;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(CN2CCCC(c3nc4ccc(N5CCOCC5)cn4n3)C2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H31N5O.C2HF3O2/c1-2-19-5-7-20(8-6-19)16-27-11-3-4-21(17-27)24-25-23-10-9-22(18-29(23)26-24)28-12-14-30-15-13-28;3-2(4,5)1(6)7/h5-10,18,21H,2-4,11-17H2,1H3;(H,6,7) |
| InChIKey | KJZIKDLZXSWNKB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |