C21H28F6N6O5 — CID 155830817
7-[8-(ethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830817) has the molecular formula C21H28F6N6O5 and a molecular weight of 558.48 g/mol. Its IUPAC name is 7-[8-(ethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-[8-(ethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830817 |
| Molecular Formula | C21H28F6N6O5 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 7-[8-(ethoxymethyl)-5-methyl-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOCC1CCN(C)C2(C1)CN(c1cc(C)nc3ncnn13)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N6O.2C2HF3O2/c1-4-24-9-14-5-6-21(3)17(8-14)10-22(11-17)15-7-13(2)20-16-18-12-19-23(15)16;2*3-2(4,5)1(6)7/h7,12,14H,4-6,8-11H2,1-3H3;2*(H,6,7) |
| InChIKey | MNVCGOUVKSWPQQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |