C24H32F6N6O5 — CID 155842732
7-[5-(cyclopropylmethyl)-8-(ethoxymethyl)-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155842732) has the molecular formula C24H32F6N6O5 and a molecular weight of 598.55 g/mol. Its IUPAC name is 7-[5-(cyclopropylmethyl)-8-(ethoxymethyl)-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-[5-(cyclopropylmethyl)-8-(ethoxymethyl)-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155842732 |
| Molecular Formula | C24H32F6N6O5 |
| Molecular Weight | 598.55 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 7-[5-(cyclopropylmethyl)-8-(ethoxymethyl)-2,5-diazaspiro[3.5]nonan-2-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOCC1CCN(CC2CC2)C2(C1)CN(c1cc(C)nc3ncnn13)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H30N6O.2C2HF3O2/c1-3-27-11-17-6-7-25(10-16-4-5-16)20(9-17)12-24(13-20)18-8-15(2)23-19-21-14-22-26(18)19;2*3-2(4,5)1(6)7/h8,14,16-17H,3-7,9-13H2,1-2H3;2*(H,6,7) |
| InChIKey | RODGYCYTEGVWIG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |