C18H25F3N2O4S — CID 155831408
(3aS,5R,7aS)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155831408) has the molecular formula C18H25F3N2O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is (3aS,5R,7aS)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,5R,7aS)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831408 |
| Molecular Formula | C18H25F3N2O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (3aS,5R,7aS)-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-(prop-2-enoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOC[C@H]1CC[C@H]2[C@H](CCN2Cc2csc(C)n2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O2S.C2HF3O2/c1-3-8-19-10-14-4-5-15-16(20-14)6-7-18(15)9-13-11-21-12(2)17-13;3-2(4,5)1(6)7/h3,11,14-16H,1,4-10H2,2H3;(H,6,7)/t14-,15+,16+;/m1./s1 |
| InChIKey | AEQIQMSABAYBPG-BZSDZJHCSA-N |
| XLogP | 3.41 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|