C15H21F3N2O4S — CID 155835110
(4aS,7R,7aR)-7-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155835110) has the molecular formula C15H21F3N2O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-7-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835110 |
| Molecular Formula | C15H21F3N2O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (4aS,7R,7aR)-7-methoxy-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1CC[C@H]2[C@H]1OCCN2Cc1csc(C)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N2O2S.C2HF3O2/c1-9-14-10(8-18-9)7-15-5-6-17-13-11(15)3-4-12(13)16-2;3-2(4,5)1(6)7/h8,11-13H,3-7H2,1-2H3;(H,6,7)/t11-,12+,13+;/m0./s1 |
| InChIKey | KCQHKKMQEPZROL-LUHWTZLKSA-N |
| XLogP | 2.46 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |