C18H25F3N2O4S — CID 155833635
(3R,3aS,7aR)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155833635) has the molecular formula C18H25F3N2O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aS,7aR)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833635 |
| Molecular Formula | C18H25F3N2O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (3R,3aS,7aR)-1-(cyclopropylmethyl)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CO[C@@H]2CN(CC3CC3)[C@@H]3CCCO[C@@H]32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N2O2S.C2HF3O2/c1-11-17-13(10-21-11)9-20-15-8-18(7-12-4-5-12)14-3-2-6-19-16(14)15;3-2(4,5)1(6)7/h10,12,14-16H,2-9H2,1H3;(H,6,7)/t14-,15-,16+;/m1./s1 |
| InChIKey | NZIYJOWTHWEUDR-IFKKJYDISA-N |
| XLogP | 3.24 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |