C20H25F3N4O5 — CID 155831499
cyclopent-3-en-1-yl-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155831499) has the molecular formula C20H25F3N4O5 and a molecular weight of 458.44 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | cyclopent-3-en-1-yl-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831499 |
| Molecular Formula | C20H25F3N4O5 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | cyclopent-3-en-1-yl-[3-(4-morpholin-4-ylpyrimidin-2-yl)morpholin-4-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C1CC=CC1)N1CCOCC1c1nccc(N2CCOCC2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N4O3.C2HF3O2/c23-18(14-3-1-2-4-14)22-9-12-25-13-15(22)17-19-6-5-16(20-17)21-7-10-24-11-8-21;3-2(4,5)1(6)7/h1-2,5-6,14-15H,3-4,7-13H2;(H,6,7) |
| InChIKey | FICBKAGTWMIXJR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|