C17H24F3N3O5S — CID 155831613
(3aR,6aR)-N-(2-methoxyethyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155831613) has the molecular formula C17H24F3N3O5S and a molecular weight of 439.46 g/mol. Its IUPAC name is (3aR,6aR)-N-(2-methoxyethyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aR)-N-(2-methoxyethyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155831613 |
| Molecular Formula | C17H24F3N3O5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (3aR,6aR)-N-(2-methoxyethyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@]12COC[C@H]1CN(Cc1nc(C)cs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O3S.C2HF3O2/c1-11-8-22-13(17-11)6-18-5-12-7-21-10-15(12,9-18)14(19)16-3-4-20-2;3-2(4,5)1(6)7/h8,12H,3-7,9-10H2,1-2H3,(H,16,19);(H,6,7)/t12-,15-;/m1./s1 |
| InChIKey | HKBZEFIUQHVNIK-XRZFDKQNSA-N |
| XLogP | 1.30 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|