C16H21F2N3O2S — CID 97422371
(3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 97422371) has the molecular formula C16H21F2N3O2S and a molecular weight of 357.43 g/mol. Its IUPAC name is (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 97422371 |
| Molecular Formula | C16H21F2N3O2S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (3aR,6aR)-N-(3,3-difluorocyclobutyl)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | Cc1csc(CN2C[C@@H]3COC[C@]3(C(=O)NC3CC(F)(F)C3)C2)n1 |
| InChI | InChI=1S/C16H21F2N3O2S/c1-10-7-24-13(19-10)5-21-4-11-6-23-9-15(11,8-21)14(22)20-12-2-16(17,18)3-12/h7,11-12H,2-6,8-9H2,1H3,(H,20,22)/t11-,15-/m1/s1 |
| InChIKey | ORMOTYNRUWQCGT-IAQYHMDHSA-N |
| XLogP | 1.81 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |