C17H23F3N4O5 — CID 155832990
N-[[4-(2-hydroxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155832990) has the molecular formula C17H23F3N4O5 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[[4-(2-hydroxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[4-(2-hydroxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155832990 |
| Molecular Formula | C17H23F3N4O5 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[[4-(2-hydroxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC1CCC2C1OCCN2CCO)c1cnccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O3.C2HF3O2/c20-7-5-19-6-8-22-14-11(1-2-13(14)19)9-18-15(21)12-10-16-3-4-17-12;3-2(4,5)1(6)7/h3-4,10-11,13-14,20H,1-2,5-9H2,(H,18,21);(H,6,7) |
| InChIKey | HRLWLYJECNTFAL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |