C17H29F3N2O6S — CID 155833617
(4aS,7R,7aR)-4-ethylsulfonyl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155833617) has the molecular formula C17H29F3N2O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-ethylsulfonyl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-ethylsulfonyl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833617 |
| Molecular Formula | C17H29F3N2O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (4aS,7R,7aR)-4-ethylsulfonyl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)N1CCO[C@H]2[C@H](OCCN3CCCC3)CC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H28N2O4S.C2HF3O2/c1-2-22(18,19)17-10-12-21-15-13(17)5-6-14(15)20-11-9-16-7-3-4-8-16;3-2(4,5)1(6)7/h13-15H,2-12H2,1H3;(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | KHPNNVUFDHROEU-ONAKXNSWSA-N |
| XLogP | 1.31 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |