C19H27F3N4O4 — CID 127021545
(4aS,7R,7aR)-4-pyrimidin-2-yl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 127021545) has the molecular formula C19H27F3N4O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-pyrimidin-2-yl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-pyrimidin-2-yl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021545 |
| Molecular Formula | C19H27F3N4O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (4aS,7R,7aR)-4-pyrimidin-2-yl-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1cnc(N2CCO[C@H]3[C@H](OCCN4CCCC4)CC[C@@H]32)nc1 |
| InChI | InChI=1S/C17H26N4O2.C2HF3O2/c1-2-9-20(8-1)10-12-22-15-5-4-14-16(15)23-13-11-21(14)17-18-6-3-7-19-17;3-2(4,5)1(6)7/h3,6-7,14-16H,1-2,4-5,8-13H2;(H,6,7)/t14-,15+,16+;/m0./s1 |
| InChIKey | XQYCGWBVSIAZEJ-FUQNERGOSA-N |
| XLogP | 1.96 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |