C22H32F3N3O4 — CID 155834757
(5S,10S)-1-(cyclobutylmethyl)-10-ethyl-9-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155834757) has the molecular formula C22H32F3N3O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is (5S,10S)-1-(cyclobutylmethyl)-10-ethyl-9-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (5S,10S)-1-(cyclobutylmethyl)-10-ethyl-9-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834757 |
| Molecular Formula | C22H32F3N3O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (5S,10S)-1-(cyclobutylmethyl)-10-ethyl-9-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,9-diazaspiro[4.5]decan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H]1N(Cc2cc(C)on2)CCC[C@]12CCC(=O)N2CC1CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H31N3O2.C2HF3O2/c1-3-18-20(10-8-19(24)23(20)13-16-6-4-7-16)9-5-11-22(18)14-17-12-15(2)25-21-17;3-2(4,5)1(6)7/h12,16,18H,3-11,13-14H2,1-2H3;(H,6,7)/t18-,20-;/m0./s1 |
| InChIKey | URFKHDMMYBEPQW-MKSBGGEFSA-N |
| XLogP | 4.15 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |