C22H29F6N3O5S — CID 155837157
(5S,10S)-10-ethyl-9-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155837157) has the molecular formula C22H29F6N3O5S and a molecular weight of 561.55 g/mol. Its IUPAC name is (5S,10S)-10-ethyl-9-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (5S,10S)-10-ethyl-9-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155837157 |
| Molecular Formula | C22H29F6N3O5S |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | (5S,10S)-10-ethyl-9-[(4-methyl-1,3-thiazol-5-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1C(=O)CC[C@]12CCCN(Cc1scnc1C)[C@H]2CC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3OS.2C2HF3O2/c1-4-10-21-17(22)7-9-18(21)8-6-11-20(16(18)5-2)12-15-14(3)19-13-23-15;2*3-2(4,5)1(6)7/h4,13,16H,1,5-12H2,2-3H3;2*(H,6,7)/t16-,18-;;/m0../s1 |
| InChIKey | LBNWTXGLTPTEGF-RYNABIAMSA-N |
| XLogP | 4.64 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|