C18H28N4O — CID 124821175
(5R,10R)-10-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one (PubChem CID 124821175) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (5R,10R)-10-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one.
| Compound Name | (5R,10R)-10-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 124821175 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (5R,10R)-10-ethyl-9-[(1-methylpyrazol-4-yl)methyl]-1-prop-2-enyl-1,9-diazaspiro[4.5]decan-2-one |
| SMILES | C=CCN1C(=O)CC[C@@]12CCCN(Cc1cnn(C)c1)[C@@H]2CC |
| InChI | InChI=1S/C18H28N4O/c1-4-10-22-17(23)7-9-18(22)8-6-11-21(16(18)5-2)14-15-12-19-20(3)13-15/h4,12-13,16H,1,5-11,14H2,2-3H3/t16-,18-/m1/s1 |
| InChIKey | VYBRSCNDPPEYLC-SJLPKXTDSA-N |
| XLogP | 2.34 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|