C21H25N3O5 — CID 155836120
formic acid;8-(furan-2-carbonyl)-2-[(6-methyl-2-pyridinyl)methyl]-2,8-diazaspiro[4.5]decan-3-one (PubChem CID 155836120) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is formic acid;8-(furan-2-carbonyl)-2-[(6-methyl-2-pyridinyl)methyl]-2,8-diazaspiro[4.5]decan-3-one.
| Compound Name | formic acid;8-(furan-2-carbonyl)-2-[(6-methyl-2-pyridinyl)methyl]-2,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 155836120 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | formic acid;8-(furan-2-carbonyl)-2-[(6-methyl-2-pyridinyl)methyl]-2,8-diazaspiro[4.5]decan-3-one |
| SMILES | Cc1cccc(CN2CC3(CCN(C(=O)c4ccco4)CC3)CC2=O)n1.O=CO |
| InChI | InChI=1S/C20H23N3O3.CH2O2/c1-15-4-2-5-16(21-15)13-23-14-20(12-18(23)24)7-9-22(10-8-20)19(25)17-6-3-11-26-17;2-1-3/h2-6,11H,7-10,12-14H2,1H3;1H,(H,2,3) |
| InChIKey | BPTCWDFIUODMKE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|